C17H16F3NO3S — CID 122110430
5-[[2-[3-(trifluoromethyl)phenyl]butanoylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110430) has the molecular formula C17H16F3NO3S and a molecular weight of 371.38 g/mol. Its IUPAC name is 5-[[2-[3-(trifluoromethyl)phenyl]butanoylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[2-[3-(trifluoromethyl)phenyl]butanoylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110430 |
| Molecular Formula | C17H16F3NO3S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 5-[[2-[3-(trifluoromethyl)phenyl]butanoylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | CCC(C(=O)NCc1ccc(C(=O)O)s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO3S/c1-2-13(10-4-3-5-11(8-10)17(18,19)20)15(22)21-9-12-6-7-14(25-12)16(23)24/h3-8,13H,2,9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | UDNPHFDDYUVPPF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |