C16H17NO4S — CID 122110496
5-[[(2-ethoxy-2-phenylacetyl)amino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110496) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is 5-[[(2-ethoxy-2-phenylacetyl)amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(2-ethoxy-2-phenylacetyl)amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110496 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-[[(2-ethoxy-2-phenylacetyl)amino]methyl]thiophene-2-carboxylic acid |
| SMILES | CCOC(C(=O)NCc1ccc(C(=O)O)s1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO4S/c1-2-21-14(11-6-4-3-5-7-11)15(18)17-10-12-8-9-13(22-12)16(19)20/h3-9,14H,2,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | VUGVSFIUMKPHQO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |