C17H27ClN2O3 — CID 120556673
2-[(3-methoxyphenyl)methoxy]-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride (PubChem CID 120556673) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methoxy]-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride.
| Compound Name | 2-[(3-methoxyphenyl)methoxy]-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120556673 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[(3-methoxyphenyl)methoxy]-N-(3-methylpiperidin-4-yl)propanamide;hydrochloride |
| SMILES | COc1cccc(COC(C)C(=O)NC2CCNCC2C)c1.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-12-10-18-8-7-16(12)19-17(20)13(2)22-11-14-5-4-6-15(9-14)21-3;/h4-6,9,12-13,16,18H,7-8,10-11H2,1-3H3,(H,19,20);1H |
| InChIKey | GMMVNJDZQLMZQH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |