C12H18BrClN2O2S — CID 120557472
5-bromo-4-methoxy-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride (PubChem CID 120557472) has the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-bromo-4-methoxy-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120557472 |
| Molecular Formula | C12H18BrClN2O2S |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-bromo-4-methoxy-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride |
| SMILES | COc1cc(C(=O)NC2CCNCC2C)sc1Br.Cl |
| InChI | InChI=1S/C12H17BrN2O2S.ClH/c1-7-6-14-4-3-8(7)15-12(16)10-5-9(17-2)11(13)18-10;/h5,7-8,14H,3-4,6H2,1-2H3,(H,15,16);1H |
| InChIKey | XRDGCQZQXLDSFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |