C17H21N3O3S — CID 120561313
methyl 2-[2-(4-aminopentanoylamino)-4-phenyl-1,3-thiazol-5-yl]acetate (PubChem CID 120561313) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl 2-[2-(4-aminopentanoylamino)-4-phenyl-1,3-thiazol-5-yl]acetate.
| Compound Name | methyl 2-[2-(4-aminopentanoylamino)-4-phenyl-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 120561313 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | methyl 2-[2-(4-aminopentanoylamino)-4-phenyl-1,3-thiazol-5-yl]acetate |
| SMILES | COC(=O)Cc1sc(NC(=O)CCC(C)N)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-11(18)8-9-14(21)19-17-20-16(12-6-4-3-5-7-12)13(24-17)10-15(22)23-2/h3-7,11H,8-10,18H2,1-2H3,(H,19,20,21) |
| InChIKey | VSERWUNKVLAAGG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |