C15H22Cl2N2O — CID 120562379
4-amino-N-[2-(2,6-dichlorophenyl)-2-methylpropyl]pentanamide (PubChem CID 120562379) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 4-amino-N-[2-(2,6-dichlorophenyl)-2-methylpropyl]pentanamide.
| Compound Name | 4-amino-N-[2-(2,6-dichlorophenyl)-2-methylpropyl]pentanamide |
|---|---|
| PubChem CID | 120562379 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-amino-N-[2-(2,6-dichlorophenyl)-2-methylpropyl]pentanamide |
| SMILES | CC(N)CCC(=O)NCC(C)(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H22Cl2N2O/c1-10(18)7-8-13(20)19-9-15(2,3)14-11(16)5-4-6-12(14)17/h4-6,10H,7-9,18H2,1-3H3,(H,19,20) |
| InChIKey | CZSWLGTTYIBFCR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |