C14H21Cl2N — CID 55195552
N-tert-butyl-2-(2,6-dichlorophenyl)-2-methylpropan-1-amine (PubChem CID 55195552) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is N-tert-butyl-2-(2,6-dichlorophenyl)-2-methylpropan-1-amine.
| Compound Name | N-tert-butyl-2-(2,6-dichlorophenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 55195552 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-tert-butyl-2-(2,6-dichlorophenyl)-2-methylpropan-1-amine |
| SMILES | CC(C)(C)NCC(C)(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H21Cl2N/c1-13(2,3)17-9-14(4,5)12-10(15)7-6-8-11(12)16/h6-8,17H,9H2,1-5H3 |
| InChIKey | RBTPJNAJVUJXTD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |