C11H21ClN2O2 — CID 120562894
4-amino-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pentanamide;hydrochloride (PubChem CID 120562894) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is 4-amino-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120562894 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-amino-N-(7-oxabicyclo[2.2.1]heptan-2-yl)pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NC1CC2CCC1O2.Cl |
| InChI | InChI=1S/C11H20N2O2.ClH/c1-7(12)2-5-11(14)13-9-6-8-3-4-10(9)15-8;/h7-10H,2-6,12H2,1H3,(H,13,14);1H |
| InChIKey | KQOZUBUVJOXJIW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |