C16H29Cl2N3O2 — CID 120564549
4-amino-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]pentanamide;dihydrochloride (PubChem CID 120564549) has the molecular formula C16H29Cl2N3O2 and a molecular weight of 366.33 g/mol. Its IUPAC name is 4-amino-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564549 |
| Molecular Formula | C16H29Cl2N3O2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-amino-N-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCc1cccc(OCCN(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O2.2ClH/c1-13(17)7-8-16(20)18-12-14-5-4-6-15(11-14)21-10-9-19(2)3;;/h4-6,11,13H,7-10,12,17H2,1-3H3,(H,18,20);2*1H |
| InChIKey | VENFOMAYEDUCRV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |