C19H21ClN6O4 — CID 120566872
N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide;hydrochloride (PubChem CID 120566872) has the molecular formula C19H21ClN6O4 and a molecular weight of 432.87 g/mol. Its IUPAC name is N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide;hydrochloride.
| Compound Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120566872 |
| Molecular Formula | C19H21ClN6O4 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide;hydrochloride |
| SMILES | Cl.NCc1nc(-c2ccc(NC(=O)CN3C(=O)C4C5CCC(O5)C4C3=O)cc2)n[nH]1 |
| InChI | InChI=1S/C19H20N6O4.ClH/c20-7-13-22-17(24-23-13)9-1-3-10(4-2-9)21-14(26)8-25-18(27)15-11-5-6-12(29-11)16(15)19(25)28;/h1-4,11-12,15-16H,5-8,20H2,(H,21,26)(H,22,23,24);1H |
| InChIKey | ZSORZDOHLPDMEY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|