C14H20ClN5OS — CID 120567008
N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 120567008) has the molecular formula C14H20ClN5OS and a molecular weight of 341.87 g/mol. Its IUPAC name is N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120567008 |
| Molecular Formula | C14H20ClN5OS |
| Molecular Weight | 341.87 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCCCC(=O)Nc1ccc(-c2n[nH]c(CN)n2)cc1.Cl |
| InChI | InChI=1S/C14H19N5OS.ClH/c1-21-8-2-3-13(20)16-11-6-4-10(5-7-11)14-17-12(9-15)18-19-14;/h4-7H,2-3,8-9,15H2,1H3,(H,16,20)(H,17,18,19);1H |
| InChIKey | BACPWJOIFMNJIL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.87 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|