C15H22ClN5O2 — CID 120566810
N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-butoxyacetamide;hydrochloride (PubChem CID 120566810) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-butoxyacetamide;hydrochloride.
| Compound Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-butoxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 120566810 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-butoxyacetamide;hydrochloride |
| SMILES | CCCCOCC(=O)Nc1ccc(-c2n[nH]c(CN)n2)cc1.Cl |
| InChI | InChI=1S/C15H21N5O2.ClH/c1-2-3-8-22-10-14(21)17-12-6-4-11(5-7-12)15-18-13(9-16)19-20-15;/h4-7H,2-3,8-10,16H2,1H3,(H,17,21)(H,18,19,20);1H |
| InChIKey | IKABJFQQMZUSOQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|