C15H21N5O3 — CID 120567029
N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(2-ethoxyethoxy)acetamide (PubChem CID 120567029) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(2-ethoxyethoxy)acetamide.
| Compound Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(2-ethoxyethoxy)acetamide |
|---|---|
| PubChem CID | 120567029 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2-(2-ethoxyethoxy)acetamide |
| SMILES | CCOCCOCC(=O)Nc1ccc(-c2n[nH]c(CN)n2)cc1 |
| InChI | InChI=1S/C15H21N5O3/c1-2-22-7-8-23-10-14(21)17-12-5-3-11(4-6-12)15-18-13(9-16)19-20-15/h3-6H,2,7-10,16H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | OAZNLOHYTYPILN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|