C21H25N5O2 — CID 120567033
N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-(2-phenylethoxy)butanamide (PubChem CID 120567033) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-(2-phenylethoxy)butanamide.
| Compound Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-(2-phenylethoxy)butanamide |
|---|---|
| PubChem CID | 120567033 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]phenyl]-4-(2-phenylethoxy)butanamide |
| SMILES | NCc1nc(-c2ccc(NC(=O)CCCOCCc3ccccc3)cc2)n[nH]1 |
| InChI | InChI=1S/C21H25N5O2/c22-15-19-24-21(26-25-19)17-8-10-18(11-9-17)23-20(27)7-4-13-28-14-12-16-5-2-1-3-6-16/h1-3,5-6,8-11H,4,7,12-15,22H2,(H,23,27)(H,24,25,26) |
| InChIKey | DITFUGMGJRMRHR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|