C10H8F3IN4O — CID 12056712
2-iodo-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine (PubChem CID 12056712) has the molecular formula C10H8F3IN4O and a molecular weight of 384.10 g/mol. Its IUPAC name is 2-iodo-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine.
| Compound Name | 2-iodo-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine |
|---|---|
| PubChem CID | 12056712 |
| Molecular Formula | C10H8F3IN4O |
| Molecular Weight | 384.10 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 2-iodo-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine |
| SMILES | Cc1cnc(I)nc1Oc1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C10H8F3IN4O/c1-5-4-15-9(14)16-8(5)19-7-3-6(10(11,12)13)17-18(7)2/h3-4H,1-2H3 |
| InChIKey | IKVFEQWSUQNAIM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|