C10H9F3N4O2 — CID 58282667
4,6-dimethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine (PubChem CID 58282667) has the molecular formula C10H9F3N4O2 and a molecular weight of 274.20 g/mol. Its IUPAC name is 4,6-dimethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine.
| Compound Name | 4,6-dimethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 58282667 |
| Molecular Formula | C10H9F3N4O2 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4,6-dimethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine |
| SMILES | COc1cc(OC)nc(-n2ccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C10H9F3N4O2/c1-18-7-5-8(19-2)15-9(14-7)17-4-3-6(16-17)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | XHMPOMUMJHPSLG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |