C13H21Cl2N3O — CID 120567166
5-methyl-N-(4-methylpiperidin-4-yl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 120567166) has the molecular formula C13H21Cl2N3O and a molecular weight of 306.24 g/mol. Its IUPAC name is 5-methyl-N-(4-methylpiperidin-4-yl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 5-methyl-N-(4-methylpiperidin-4-yl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120567166 |
| Molecular Formula | C13H21Cl2N3O |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 5-methyl-N-(4-methylpiperidin-4-yl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cc1cncc(C(=O)NC2(C)CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C13H19N3O.2ClH/c1-10-7-11(9-15-8-10)12(17)16-13(2)3-5-14-6-4-13;;/h7-9,14H,3-6H2,1-2H3,(H,16,17);2*1H |
| InChIKey | IIZUQMHYSIIWCG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |