C13H16F3N3O — CID 114696387
N-(4-methylpiperidin-4-yl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 114696387) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is N-(4-methylpiperidin-4-yl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-methylpiperidin-4-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114696387 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(4-methylpiperidin-4-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC1(NC(=O)c2ccc(C(F)(F)F)nc2)CCNCC1 |
| InChI | InChI=1S/C13H16F3N3O/c1-12(4-6-17-7-5-12)19-11(20)9-2-3-10(18-8-9)13(14,15)16/h2-3,8,17H,4-7H2,1H3,(H,19,20) |
| InChIKey | CARSSQGKMWKFTA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |