About N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide
N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 120671037) has the molecular formula C15H20F3N3O
and a molecular weight of 315.34 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| PubChem CID | 120671037 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC1(C)CCCNC1CNC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H20F3N3O/c1-14(2)6-3-7-19-12(14)9-21-13(22)10-4-5-11(20-8-10)15(16,17)18/h4-5,8,12,19H,3,6-7,9H2,1-2H3,(H,21,22) |
| InChIKey | NZPYHWTXLOPPKT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The IUPAC name of N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide (CID 120671037) is N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
What is the SMILES notation for N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The canonical SMILES for N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide is CC1(C)CCCNC1CNC(=O)c1ccc(C(F)(F)F)nc1.
What is the InChIKey of N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The InChIKey is NZPYHWTXLOPPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3N3O/c1-14(2)6-3-7-19-12(14)9-21-13(22)10-4-5-11(20-8-10)15(16,17)18/h4-5,8,12,19H,3,6-7,9H2,1-2H3,(H,21,22).
What are the key properties of N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide has a molecular weight of 315.34 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-dimethylpiperidin-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide is sourced from PubChem (CID 120671037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).