C15H20FN3O3 — CID 120670675
N-[(3,3-dimethylpiperidin-2-yl)methyl]-2-fluoro-4-nitrobenzamide (PubChem CID 120670675) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-2-fluoro-4-nitrobenzamide.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 120670675 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2-fluoro-4-nitrobenzamide |
| SMILES | CC1(C)CCCNC1CNC(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C15H20FN3O3/c1-15(2)6-3-7-17-13(15)9-18-14(20)11-5-4-10(19(21)22)8-12(11)16/h4-5,8,13,17H,3,6-7,9H2,1-2H3,(H,18,20) |
| InChIKey | FIJHGYLEMPSJGJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|