C18H28N2O4 — CID 120670977
N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trimethoxybenzamide (PubChem CID 120670977) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 120670977 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2NCCCC2(C)C)c(OC)c1OC |
| InChI | InChI=1S/C18H28N2O4/c1-18(2)9-6-10-19-14(18)11-20-17(21)12-7-8-13(22-3)16(24-5)15(12)23-4/h7-8,14,19H,6,9-11H2,1-5H3,(H,20,21) |
| InChIKey | OCJZJMJFRVLFJF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |