C15H21ClFN3O3 — CID 120670951
N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-fluoro-2-nitrobenzamide;hydrochloride (PubChem CID 120670951) has the molecular formula C15H21ClFN3O3 and a molecular weight of 345.80 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-fluoro-2-nitrobenzamide;hydrochloride.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-fluoro-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120670951 |
| Molecular Formula | C15H21ClFN3O3 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-fluoro-2-nitrobenzamide;hydrochloride |
| SMILES | CC1(C)CCCNC1CNC(=O)c1cc(F)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H20FN3O3.ClH/c1-15(2)6-3-7-17-13(15)9-18-14(20)11-8-10(16)4-5-12(11)19(21)22;/h4-5,8,13,17H,3,6-7,9H2,1-2H3,(H,18,20);1H |
| InChIKey | ARRISZQDJBVYBQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|