C18H23N3O — CID 120670665
N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-6-carboxamide (PubChem CID 120670665) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-6-carboxamide.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 120670665 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-6-carboxamide |
| SMILES | CC1(C)CCCNC1CNC(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H23N3O/c1-18(2)8-4-10-20-16(18)12-21-17(22)14-6-7-15-13(11-14)5-3-9-19-15/h3,5-7,9,11,16,20H,4,8,10,12H2,1-2H3,(H,21,22) |
| InChIKey | LAEQDUOLTSHQAN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |