C13H14F4N2 — CID 163385678
5-[1-(4-fluoropiperidin-4-yl)ethenyl]-2-(trifluoromethyl)pyridine (PubChem CID 163385678) has the molecular formula C13H14F4N2 and a molecular weight of 274.26 g/mol. Its IUPAC name is 5-[1-(4-fluoropiperidin-4-yl)ethenyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[1-(4-fluoropiperidin-4-yl)ethenyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 163385678 |
| Molecular Formula | C13H14F4N2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-[1-(4-fluoropiperidin-4-yl)ethenyl]-2-(trifluoromethyl)pyridine |
| SMILES | C=C(c1ccc(C(F)(F)F)nc1)C1(F)CCNCC1 |
| InChI | InChI=1S/C13H14F4N2/c1-9(12(14)4-6-18-7-5-12)10-2-3-11(19-8-10)13(15,16)17/h2-3,8,18H,1,4-7H2 |
| InChIKey | SDCBISBGKLDGNZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |