C24H29Cl2N3O2 — CID 120567890
N-(2-amino-1-naphthalen-2-ylethyl)-4-benzylmorpholine-2-carboxamide;dihydrochloride (PubChem CID 120567890) has the molecular formula C24H29Cl2N3O2 and a molecular weight of 462.42 g/mol. Its IUPAC name is N-(2-amino-1-naphthalen-2-ylethyl)-4-benzylmorpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-benzylmorpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120567890 |
| Molecular Formula | C24H29Cl2N3O2 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-benzylmorpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(NC(=O)C1CN(Cc2ccccc2)CCO1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27N3O2.2ClH/c25-15-22(21-11-10-19-8-4-5-9-20(19)14-21)26-24(28)23-17-27(12-13-29-23)16-18-6-2-1-3-7-18;;/h1-11,14,22-23H,12-13,15-17,25H2,(H,26,28);2*1H |
| InChIKey | ZETCFTNUWSAIQZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |