C18H22ClFN2O — CID 120568045
N-(5-amino-2-methylphenyl)-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride (PubChem CID 120568045) has the molecular formula C18H22ClFN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120568045 |
| Molecular Formula | C18H22ClFN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)C(C)CCc1cccc(F)c1.Cl |
| InChI | InChI=1S/C18H21FN2O.ClH/c1-12-7-9-16(20)11-17(12)21-18(22)13(2)6-8-14-4-3-5-15(19)10-14;/h3-5,7,9-11,13H,6,8,20H2,1-2H3,(H,21,22);1H |
| InChIKey | BFEKATZNTJIABE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|