C13H27ClN2OS — CID 120569467
3-butylsulfanyl-1-(2,3-dimethylpiperazin-1-yl)propan-1-one;hydrochloride (PubChem CID 120569467) has the molecular formula C13H27ClN2OS and a molecular weight of 294.89 g/mol. Its IUPAC name is 3-butylsulfanyl-1-(2,3-dimethylpiperazin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 3-butylsulfanyl-1-(2,3-dimethylpiperazin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120569467 |
| Molecular Formula | C13H27ClN2OS |
| Molecular Weight | 294.89 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-butylsulfanyl-1-(2,3-dimethylpiperazin-1-yl)propan-1-one;hydrochloride |
| SMILES | CCCCSCCC(=O)N1CCNC(C)C1C.Cl |
| InChI | InChI=1S/C13H26N2OS.ClH/c1-4-5-9-17-10-6-13(16)15-8-7-14-11(2)12(15)3;/h11-12,14H,4-10H2,1-3H3;1H |
| InChIKey | HGBSVULBHJRPNW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|