C15H18N2OS — CID 120571458
1-benzothiophen-5-yl-(2,3-dimethylpiperazin-1-yl)methanone (PubChem CID 120571458) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-benzothiophen-5-yl-(2,3-dimethylpiperazin-1-yl)methanone.
| Compound Name | 1-benzothiophen-5-yl-(2,3-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120571458 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-benzothiophen-5-yl-(2,3-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1NCCN(C(=O)c2ccc3sccc3c2)C1C |
| InChI | InChI=1S/C15H18N2OS/c1-10-11(2)17(7-6-16-10)15(18)13-3-4-14-12(9-13)5-8-19-14/h3-5,8-11,16H,6-7H2,1-2H3 |
| InChIKey | ICPUTXDSPPQDRA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |