C11H17N3O3S2 — CID 120571641
4-(2,3-dimethylpiperazine-1-carbonyl)thiophene-2-sulfonamide (PubChem CID 120571641) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperazine-1-carbonyl)thiophene-2-sulfonamide.
| Compound Name | 4-(2,3-dimethylpiperazine-1-carbonyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 120571641 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(2,3-dimethylpiperazine-1-carbonyl)thiophene-2-sulfonamide |
| SMILES | CC1NCCN(C(=O)c2csc(S(N)(=O)=O)c2)C1C |
| InChI | InChI=1S/C11H17N3O3S2/c1-7-8(2)14(4-3-13-7)11(15)9-5-10(18-6-9)19(12,16)17/h5-8,13H,3-4H2,1-2H3,(H2,12,16,17) |
| InChIKey | QLGAROWYDQOXGY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |