C9H15F3N2OS — CID 120574103
N-(2-methylpiperidin-3-yl)-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 120574103) has the molecular formula C9H15F3N2OS and a molecular weight of 256.29 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-(2-methylpiperidin-3-yl)-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 120574103 |
| Molecular Formula | C9H15F3N2OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CC1NCCCC1NC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2OS/c1-6-7(3-2-4-13-6)14-8(15)5-16-9(10,11)12/h6-7,13H,2-5H2,1H3,(H,14,15) |
| InChIKey | KZSSNZVHNQTMFS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |