C18H22ClN3O2 — CID 120574114
N-(2-methylpiperidin-3-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride (PubChem CID 120574114) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120574114 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)c1ccc(-c2ccccc2)[nH]c1=O.Cl |
| InChI | InChI=1S/C18H21N3O2.ClH/c1-12-15(8-5-11-19-12)20-17(22)14-9-10-16(21-18(14)23)13-6-3-2-4-7-13;/h2-4,6-7,9-10,12,15,19H,5,8,11H2,1H3,(H,20,22)(H,21,23);1H |
| InChIKey | WZRYWGZTBCCZPT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |