C16H18ClN3O2 — CID 120574779
5-(3-chlorophenyl)-N-(2-methylpiperidin-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 120574779) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-(2-methylpiperidin-3-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-(2-methylpiperidin-3-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 120574779 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-(3-chlorophenyl)-N-(2-methylpiperidin-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CC1NCCCC1NC(=O)c1cc(-c2cccc(Cl)c2)on1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-10-13(6-3-7-18-10)19-16(21)14-9-15(22-20-14)11-4-2-5-12(17)8-11/h2,4-5,8-10,13,18H,3,6-7H2,1H3,(H,19,21) |
| InChIKey | HYIOJSUYURROHM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |