C15H19ClN6O — CID 120575453
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylpiperidin-3-yl)acetamide (PubChem CID 120575453) has the molecular formula C15H19ClN6O and a molecular weight of 334.81 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylpiperidin-3-yl)acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 120575453 |
| Molecular Formula | C15H19ClN6O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N-(2-methylpiperidin-3-yl)acetamide |
| SMILES | CC1NCCCC1NC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H19ClN6O/c1-10-13(3-2-8-17-10)18-14(23)9-22-20-15(19-21-22)11-4-6-12(16)7-5-11/h4-7,10,13,17H,2-3,8-9H2,1H3,(H,18,23) |
| InChIKey | UWSHNMHHLZOBEN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |