C14H20Cl2N2O3S — CID 120576176
2-(4-chlorophenyl)sulfonyl-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride (PubChem CID 120576176) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120576176 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)CS(=O)(=O)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H19ClN2O3S.ClH/c1-10-13(3-2-8-16-10)17-14(18)9-21(19,20)12-6-4-11(15)5-7-12;/h4-7,10,13,16H,2-3,8-9H2,1H3,(H,17,18);1H |
| InChIKey | ZIBIZTLOGDIRBE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |