C15H25ClN4O — CID 120575792
2-methyl-N-(2-methylpiperidin-3-yl)-4-propan-2-ylpyrimidine-5-carboxamide;hydrochloride (PubChem CID 120575792) has the molecular formula C15H25ClN4O and a molecular weight of 312.85 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpiperidin-3-yl)-4-propan-2-ylpyrimidine-5-carboxamide;hydrochloride.
| Compound Name | 2-methyl-N-(2-methylpiperidin-3-yl)-4-propan-2-ylpyrimidine-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120575792 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-methyl-N-(2-methylpiperidin-3-yl)-4-propan-2-ylpyrimidine-5-carboxamide;hydrochloride |
| SMILES | Cc1ncc(C(=O)NC2CCCNC2C)c(C(C)C)n1.Cl |
| InChI | InChI=1S/C15H24N4O.ClH/c1-9(2)14-12(8-17-11(4)18-14)15(20)19-13-6-5-7-16-10(13)3;/h8-10,13,16H,5-7H2,1-4H3,(H,19,20);1H |
| InChIKey | KJSTVJBYWVPRSU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |