C14H19Cl2FN4O — CID 120576857
6-fluoro-N-(2-methylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 120576857) has the molecular formula C14H19Cl2FN4O and a molecular weight of 349.24 g/mol. Its IUPAC name is 6-fluoro-N-(2-methylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | 6-fluoro-N-(2-methylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120576857 |
| Molecular Formula | C14H19Cl2FN4O |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-fluoro-N-(2-methylpiperidin-3-yl)-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | CC1NCCCC1NC(=O)c1cc(F)cc2[nH]cnc12.Cl.Cl |
| InChI | InChI=1S/C14H17FN4O.2ClH/c1-8-11(3-2-4-16-8)19-14(20)10-5-9(15)6-12-13(10)18-7-17-12;;/h5-8,11,16H,2-4H2,1H3,(H,17,18)(H,19,20);2*1H |
| InChIKey | MPFKJGJLPWLMHV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |