C13H17Cl2FN4O — CID 119385720
6-fluoro-N-piperidin-4-yl-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 119385720) has the molecular formula C13H17Cl2FN4O and a molecular weight of 335.21 g/mol. Its IUPAC name is 6-fluoro-N-piperidin-4-yl-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | 6-fluoro-N-piperidin-4-yl-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119385720 |
| Molecular Formula | C13H17Cl2FN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-fluoro-N-piperidin-4-yl-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCNCC1)c1cc(F)cc2[nH]cnc12 |
| InChI | InChI=1S/C13H15FN4O.2ClH/c14-8-5-10(12-11(6-8)16-7-17-12)13(19)18-9-1-3-15-4-2-9;;/h5-7,9,15H,1-4H2,(H,16,17)(H,18,19);2*1H |
| InChIKey | MXCDCDROQNFKEU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |