C18H27ClN2O3 — CID 120575882
4-(3-acetylphenoxy)-N-(2-methylpiperidin-3-yl)butanamide;hydrochloride (PubChem CID 120575882) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 4-(3-acetylphenoxy)-N-(2-methylpiperidin-3-yl)butanamide;hydrochloride.
| Compound Name | 4-(3-acetylphenoxy)-N-(2-methylpiperidin-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120575882 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-(3-acetylphenoxy)-N-(2-methylpiperidin-3-yl)butanamide;hydrochloride |
| SMILES | CC(=O)c1cccc(OCCCC(=O)NC2CCCNC2C)c1.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-13-17(8-4-10-19-13)20-18(22)9-5-11-23-16-7-3-6-15(12-16)14(2)21;/h3,6-7,12-13,17,19H,4-5,8-11H2,1-2H3,(H,20,22);1H |
| InChIKey | RJUWXZNFURDGGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|