C19H28N2O — CID 120576328
N-(2-methylpiperidin-3-yl)-4-phenylcyclohexane-1-carboxamide (PubChem CID 120576328) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-4-phenylcyclohexane-1-carboxamide.
| Compound Name | N-(2-methylpiperidin-3-yl)-4-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 120576328 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-4-phenylcyclohexane-1-carboxamide |
| SMILES | CC1NCCCC1NC(=O)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O/c1-14-18(8-5-13-20-14)21-19(22)17-11-9-16(10-12-17)15-6-3-2-4-7-15/h2-4,6-7,14,16-18,20H,5,8-13H2,1H3,(H,21,22) |
| InChIKey | BGBLXCURQPGLIO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |