C18H27ClN2O — CID 120577312
N-(2-methylpiperidin-3-yl)-1-phenylcyclopentane-1-carboxamide;hydrochloride (PubChem CID 120577312) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-1-phenylcyclopentane-1-carboxamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-1-phenylcyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120577312 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-1-phenylcyclopentane-1-carboxamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)C1(c2ccccc2)CCCC1.Cl |
| InChI | InChI=1S/C18H26N2O.ClH/c1-14-16(10-7-13-19-14)20-17(21)18(11-5-6-12-18)15-8-3-2-4-9-15;/h2-4,8-9,14,16,19H,5-7,10-13H2,1H3,(H,20,21);1H |
| InChIKey | KHYSEUXNFTUHRZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |