C18H26Cl2N2O2 — CID 120576460
4-(2-chlorophenyl)-N-(2-methylpiperidin-3-yl)oxane-4-carboxamide;hydrochloride (PubChem CID 120576460) has the molecular formula C18H26Cl2N2O2 and a molecular weight of 373.32 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(2-methylpiperidin-3-yl)oxane-4-carboxamide;hydrochloride.
| Compound Name | 4-(2-chlorophenyl)-N-(2-methylpiperidin-3-yl)oxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120576460 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(2-methylpiperidin-3-yl)oxane-4-carboxamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)C1(c2ccccc2Cl)CCOCC1.Cl |
| InChI | InChI=1S/C18H25ClN2O2.ClH/c1-13-16(7-4-10-20-13)21-17(22)18(8-11-23-12-9-18)14-5-2-3-6-15(14)19;/h2-3,5-6,13,16,20H,4,7-12H2,1H3,(H,21,22);1H |
| InChIKey | OFRZMEBYLSARCL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |