C18H26ClN3O3 — CID 120577029
(3R)-4-benzyl-N-(2-methylpiperidin-3-yl)-5-oxomorpholine-3-carboxamide;hydrochloride (PubChem CID 120577029) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is (3R)-4-benzyl-N-(2-methylpiperidin-3-yl)-5-oxomorpholine-3-carboxamide;hydrochloride.
| Compound Name | (3R)-4-benzyl-N-(2-methylpiperidin-3-yl)-5-oxomorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120577029 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (3R)-4-benzyl-N-(2-methylpiperidin-3-yl)-5-oxomorpholine-3-carboxamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)[C@H]1COCC(=O)N1Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H25N3O3.ClH/c1-13-15(8-5-9-19-13)20-18(23)16-11-24-12-17(22)21(16)10-14-6-3-2-4-7-14;/h2-4,6-7,13,15-16,19H,5,8-12H2,1H3,(H,20,23);1H/t13?,15?,16-;/m1./s1 |
| InChIKey | KFRDDNOGTDPYMN-SQUGVSCCSA-N |
| XLogP | 1.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |