About 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide
4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide (PubChem CID 71792156) has the molecular formula C16H22N2O5
and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide |
| PubChem CID | 71792156 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide |
| SMILES | CC(CO)(CO)NC(=O)C1COCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O5/c1-16(10-19,11-20)17-15(22)13-8-23-9-14(21)18(13)7-12-5-3-2-4-6-12/h2-6,13,19-20H,7-11H2,1H3,(H,17,22) |
| InChIKey | XDWNKJJKQFEILI-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide?
The IUPAC name of 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide (CID 71792156) is 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide.
What is the SMILES notation for 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide?
The canonical SMILES for 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide is CC(CO)(CO)NC(=O)C1COCC(=O)N1Cc1ccccc1.
What is the InChIKey of 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide?
The InChIKey is XDWNKJJKQFEILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O5/c1-16(10-19,11-20)17-15(22)13-8-23-9-14(21)18(13)7-12-5-3-2-4-6-12/h2-6,13,19-20H,7-11H2,1H3,(H,17,22).
What are the key properties of 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide?
4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide has a molecular weight of 322.36 g/mol, XLogP of -0.73, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(1,3-dihydroxy-2-methylpropan-2-yl)-5-oxomorpholine-3-carboxamide is sourced from PubChem (CID 71792156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).