C16H18N4O3 — CID 97066023
(3S)-4-benzyl-N-(5-methyl-1H-pyrazol-4-yl)-5-oxomorpholine-3-carboxamide (PubChem CID 97066023) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is (3S)-4-benzyl-N-(5-methyl-1H-pyrazol-4-yl)-5-oxomorpholine-3-carboxamide.
| Compound Name | (3S)-4-benzyl-N-(5-methyl-1H-pyrazol-4-yl)-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 97066023 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3S)-4-benzyl-N-(5-methyl-1H-pyrazol-4-yl)-5-oxomorpholine-3-carboxamide |
| SMILES | Cc1[nH]ncc1NC(=O)[C@@H]1COCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H18N4O3/c1-11-13(7-17-19-11)18-16(22)14-9-23-10-15(21)20(14)8-12-5-3-2-4-6-12/h2-7,14H,8-10H2,1H3,(H,17,19)(H,18,22)/t14-/m0/s1 |
| InChIKey | YYPQBNOVPHHOQP-AWEZNQCLSA-N |
| XLogP | 1.08 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |