C18H17ClN2O4 — CID 56765990
4-benzyl-N-(5-chloro-2-hydroxyphenyl)-5-oxomorpholine-3-carboxamide (PubChem CID 56765990) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 4-benzyl-N-(5-chloro-2-hydroxyphenyl)-5-oxomorpholine-3-carboxamide.
| Compound Name | 4-benzyl-N-(5-chloro-2-hydroxyphenyl)-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 56765990 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-benzyl-N-(5-chloro-2-hydroxyphenyl)-5-oxomorpholine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)C1COCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O4/c19-13-6-7-16(22)14(8-13)20-18(24)15-10-25-11-17(23)21(15)9-12-4-2-1-3-5-12/h1-8,15,22H,9-11H2,(H,20,24) |
| InChIKey | NBLGWKIMBZQKQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|