C17H32N4O3 — CID 120578067
N-[3-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-3-oxopropyl]-3-methylbutanamide (PubChem CID 120578067) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[3-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-3-oxopropyl]-3-methylbutanamide.
| Compound Name | N-[3-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-3-oxopropyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 120578067 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-[3-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-3-oxopropyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCCC(=O)N1CCCCC1CNC(=O)CCN |
| InChI | InChI=1S/C17H32N4O3/c1-13(2)11-16(23)19-9-7-17(24)21-10-4-3-5-14(21)12-20-15(22)6-8-18/h13-14H,3-12,18H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | UEOOECGTBZVKEE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |