C15H10Cl2N4O3 — CID 1205869
N-(2,3-dichlorophenyl)-2-(5-nitroindazol-1-yl)acetamide (PubChem CID 1205869) has the molecular formula C15H10Cl2N4O3 and a molecular weight of 365.18 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(5-nitroindazol-1-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(5-nitroindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 1205869 |
| Molecular Formula | C15H10Cl2N4O3 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(5-nitroindazol-1-yl)acetamide |
| SMILES | O=C(Cn1ncc2cc([N+](=O)[O-])ccc21)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl2N4O3/c16-11-2-1-3-12(15(11)17)19-14(22)8-20-13-5-4-10(21(23)24)6-9(13)7-18-20/h1-7H,8H2,(H,19,22) |
| InChIKey | HNDZBPGIADFSOI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|