C13H10Cl2N4O4 — CID 2585037
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 2585037) has the molecular formula C13H10Cl2N4O4 and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2585037 |
| Molecular Formula | C13H10Cl2N4O4 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10Cl2N4O4/c1-7-9(3-2-4-10(7)19(22)23)17-11(20)6-18-13(21)12(15)8(14)5-16-18/h2-5H,6H2,1H3,(H,17,20) |
| InChIKey | YPHOZYPRNGTNJE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|