C19H16N4O4 — CID 46260245
2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 46260245) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46260245 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)Cn2ncc3c2-c2ccccc2OC3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O4/c1-12-15(6-4-7-16(12)23(25)26)21-18(24)10-22-19-13(9-20-22)11-27-17-8-3-2-5-14(17)19/h2-9H,10-11H2,1H3,(H,21,24) |
| InChIKey | NGCYMBNVSITVPH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|