C19H20N2O5 — CID 9395132
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 9395132) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9395132 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)COc2cccc3c2OC(C)(C)C3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O5/c1-12-14(7-5-8-15(12)21(23)24)20-17(22)11-25-16-9-4-6-13-10-19(2,3)26-18(13)16/h4-9H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | NPLDJTCVQPOHIX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|